Glycochenodeoxycholic acid
Catalog No. A22444
Glycochenodeoxycholic acid (Chenodeoxycholylglycine) is a bile acid formed in the liver from chenodeoxycholate and glycine. It acts as a detergent to solubilize fats for absorption and is itself absorbed. Glycochenodeoxycholic acid (Chenodeoxycholylglycine) induces hepatocyte apoptosis.
| Catalog Num | A22444 |
|---|---|
| M. Wt | 449.62 |
| Formula | C26H43NO5 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 640-79-9 |
| Synonyms | Chenodeoxycholylglycine |
| SMILES | C[C@@]12[C@](CC[C@]2([H])[C@H](C)CCC(NCC(O)=O)=O)([H])[C@@]3([H])[C@]([C@@]4([C@](C[C@H](O)CC4)([H])C[C@H]3O)C)([H])CC1 |
Glycochenodeoxycholic acid (Chenodeoxycholylglycine) is a bile acid formed in the liver from chenodeoxycholate and glycine. It acts as a detergent to solubilize fats for absorption and is itself absorbed. Glycochenodeoxycholic acid (Chenodeoxycholylglycine) induces hepatocyte apoptosis.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.24 mL | 111.21 mL | 222.41 mL |
| 0.5 mM | 4.45 mL | 22.24 mL | 44.48 mL |
| 1 mM | 2.22 mL | 11.12 mL | 22.24 mL |
| 5 mM | 0.44 mL | 2.22 mL | 4.45 mL |
*The above data is based on the productmolecular weight 449.62. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.