Glycochenodeoxycholic acid sodium salt
Catalog No. A22447
Glycochenodeoxycholic acid sodium salt (Chenodeoxycholylglycine sodium salt) is a bile acid formed in the liver from chenodeoxycholate and glycine. It acts as a detergent to solubilize fats for absorption and is itself absorbed. Glycochenodeoxycholic acid sodium salt (Chenodeoxycholylglycine sodium salt) induces hepatocyte apoptosis.
| Catalog Num | A22447 |
|---|---|
| M. Wt | 471.61 |
| Formula | C26H42NNaO5 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 16564-43-5 |
| Synonyms | Chenodeoxycholylglycine sodium salt, Sodium glycochenodeoxycholate |
| SMILES | C[C@@]12[C@](CC[C@]2([H])[C@H](C)CCC(NCC(O[Na])=O)=O)([H])[C@@]3([H])[C@]([C@@]4([C@](C[C@H](O)CC4)([H])C[C@H]3O)C)([H])CC1 |
Glycochenodeoxycholic acid sodium salt (Chenodeoxycholylglycine sodium salt) is a bile acid formed in the liver from chenodeoxycholate and glycine. It acts as a detergent to solubilize fats for absorption and is itself absorbed. Glycochenodeoxycholic acid sodium salt (Chenodeoxycholylglycine sodium salt) induces hepatocyte apoptosis.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.2 mL | 106.02 mL | 212.04 mL |
| 0.5 mM | 4.24 mL | 21.2 mL | 42.41 mL |
| 1 mM | 2.12 mL | 10.6 mL | 21.2 mL |
| 5 mM | 0.42 mL | 2.12 mL | 4.24 mL |
*The above data is based on the productmolecular weight 471.61. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.