JTE-013
Catalog No. A22583
JTE-013 is a potent and specific S1P2 (Sphingosine-1-Phosphate 2; EDG-5) antagonist. JTE-013 inhibits the specific binding of radiolabeled S1P to human and rat S1P2 with IC50s of 17 nM and 22 nM, respectively.
| Catalog Num | A22583 |
|---|---|
| M. Wt | 408.29 |
| Formula | C17H19Cl2N7O |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 383150-41-2 |
| Synonyms | |
| SMILES | CC(C1=C2C(N(C)N=C2C)=NC(NNC(NC3=CC(Cl)=NC(Cl)=C3)=O)=C1)C |
JTE-013 is a potent and specific S1P2 (Sphingosine-1-Phosphate 2; EDG-5) antagonist. JTE-013 inhibits the specific binding of radiolabeled S1P to human and rat S1P2 with IC50s of 17 nM and 22 nM, respectively.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.49 mL | 122.46 mL | 244.92 mL |
| 0.5 mM | 4.9 mL | 24.49 mL | 48.98 mL |
| 1 mM | 2.45 mL | 12.25 mL | 24.49 mL |
| 5 mM | 0.49 mL | 2.45 mL | 4.9 mL |
*The above data is based on the productmolecular weight 408.29. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.