Triptorelin
Catalog No. A22621
Triptorelin is a synthetic gonadotropin-releasing hormone (GnRH) peptide agonist that binds to the GnRH receptor. It inhibits the growth of DU145, LNCaP, and PC3 prostate and OVCAR-3 ovarian cancer cells.
| Catalog Num | A22621 |
|---|---|
| M. Wt | 1311.47 |
| Formula | C64H82N18O13 |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 57773-63-4 |
| Synonyms | |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](Cc3ccc(O)cc3)NC(=O)[C@H](CO)NC(=O)[C@H](Cc4c[nH]c5ccccc45)NC(=O)[C@H](Cc6c[nH]cn6)NC(=O)[C@@H]7CCC(=O)N7)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N8CCC[C@H]8C(=O)NCC(=O)N |
Triptorelin is a synthetic gonadotropin-releasing hormone (GnRH) peptide agonist that binds to the GnRH receptor. It inhibits the growth of DU145, LNCaP, and PC3 prostate and OVCAR-3 ovarian cancer cells.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 7.63 mL | 38.13 mL | 76.25 mL |
| 0.5 mM | 1.53 mL | 7.63 mL | 15.25 mL |
| 1 mM | 0.76 mL | 3.81 mL | 7.63 mL |
| 5 mM | 0.15 mL | 0.76 mL | 1.53 mL |
*The above data is based on the productmolecular weight 1311.47. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.