Methoxy-PMS
Catalog No. A22647
Methoxy-PMS (1-Methoxy PMS), an active oxygen formation inducer, is stable electron-transport mediator between NAD(P)H and tetrazolium dyes.
| Catalog Num | A22647 |
|---|---|
| M. Wt | 336.36 |
| Formula | C15H16N2O5S |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 65162-13-2 |
| Synonyms | 1-Methoxy PMS; 1-Methoxyphenazine methosulfate |
| SMILES | C[N+]1=C2C=CC=CC2=NC3=C1C=CC=C3OC.O=S(OC)([O-])=O |
Methoxy-PMS (1-Methoxy PMS), an active oxygen formation inducer, is stable electron-transport mediator between NAD(P)H and tetrazolium dyes.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.73 mL | 148.65 mL | 297.3 mL |
| 0.5 mM | 5.95 mL | 29.73 mL | 59.46 mL |
| 1 mM | 2.97 mL | 14.87 mL | 29.73 mL |
| 5 mM | 0.59 mL | 2.97 mL | 5.95 mL |
*The above data is based on the productmolecular weight 336.36. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: sales@adooq.com
ADOOQ 产品质量保证
We promise all products to perform as described.